C23H32N4O2 — CID 162911768
(3R,3aS,8aR,9aR)-5,8a-dimethyl-3-[(4-pyrimidin-2-ylpiperazin-1-yl)methyl]-3,3a,4,6,7,8,9,9a-octahydrobenzo[f][1]benzofuran-2-one (PubChem CID 162911768) has the molecular formula C23H32N4O2 and a molecular weight of 396.54 g/mol. Its IUPAC name is (3R,3aS,8aR,9aR)-5,8a-dimethyl-3-[(4-pyrimidin-2-ylpiperazin-1-yl)methyl]-3,3a,4,6,7,8,9,9a-octahydrobenzo[f][1]benzofuran-2-one.
| Compound Name | (3R,3aS,8aR,9aR)-5,8a-dimethyl-3-[(4-pyrimidin-2-ylpiperazin-1-yl)methyl]-3,3a,4,6,7,8,9,9a-octahydrobenzo[f][1]benzofuran-2-one |
|---|---|
| PubChem CID | 162911768 |
| Molecular Formula | C23H32N4O2 |
| Molecular Weight | 396.54 g/mol |
| Exact Mass | 396.25 |
| IUPAC Name | (3R,3aS,8aR,9aR)-5,8a-dimethyl-3-[(4-pyrimidin-2-ylpiperazin-1-yl)methyl]-3,3a,4,6,7,8,9,9a-octahydrobenzo[f][1]benzofuran-2-one |
| SMILES | CC1=C2C[C@H]3[C@H](CN4CCN(c5ncccn5)CC4)C(=O)O[C@@H]3C[C@@]2(C)CCC1 |
| InChI | InChI=1S/C23H32N4O2/c1-16-5-3-6-23(2)14-20-17(13-19(16)23)18(21(28)29-20)15-26-9-11-27(12-10-26)22-24-7-4-8-25-22/h4,7-8,17-18,20H,3,5-6,9-15H2,1-2H3/t17-,18-,20+,23+/m0/s1 |
| InChIKey | MHZZOJLQEQTWPH-DSXMGRQXSA-N |
| XLogP | 3.06 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.54 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|