C20H25N3O6 — CID 162911964
methyl 2-[7-hydroxy-1'-[(4-methoxyphenyl)methyl]-1,3-dioxospiro[6,7,8,8a-tetrahydropyrrolo[1,2-a]pyrazine-4,3'-azetidine]-2-yl]acetate (PubChem CID 162911964) has the molecular formula C20H25N3O6 and a molecular weight of 403.44 g/mol. Its IUPAC name is methyl 2-[7-hydroxy-1'-[(4-methoxyphenyl)methyl]-1,3-dioxospiro[6,7,8,8a-tetrahydropyrrolo[1,2-a]pyrazine-4,3'-azetidine]-2-yl]acetate.
| Compound Name | methyl 2-[7-hydroxy-1'-[(4-methoxyphenyl)methyl]-1,3-dioxospiro[6,7,8,8a-tetrahydropyrrolo[1,2-a]pyrazine-4,3'-azetidine]-2-yl]acetate |
|---|---|
| PubChem CID | 162911964 |
| Molecular Formula | C20H25N3O6 |
| Molecular Weight | 403.44 g/mol |
| Exact Mass | 403.17 |
| IUPAC Name | methyl 2-[7-hydroxy-1'-[(4-methoxyphenyl)methyl]-1,3-dioxospiro[6,7,8,8a-tetrahydropyrrolo[1,2-a]pyrazine-4,3'-azetidine]-2-yl]acetate |
| SMILES | COC(=O)CN1C(=O)C2CC(O)CN2C2(CN(Cc3ccc(OC)cc3)C2)C1=O |
| InChI | InChI=1S/C20H25N3O6/c1-28-15-5-3-13(4-6-15)8-21-11-20(12-21)19(27)22(10-17(25)29-2)18(26)16-7-14(24)9-23(16)20/h3-6,14,16,24H,7-12H2,1-2H3 |
| InChIKey | BDUHRAXHKJLENK-UHFFFAOYSA-N |
| XLogP | -0.77 |
| TPSA | 99.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.44 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|