C22H23NO4 — CID 162912053
[(1R,3R,5S,6R)-6-benzoyloxy-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] benzoate (PubChem CID 162912053) has the molecular formula C22H23NO4 and a molecular weight of 365.43 g/mol. Its IUPAC name is [(1R,3R,5S,6R)-6-benzoyloxy-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] benzoate.
| Compound Name | [(1R,3R,5S,6R)-6-benzoyloxy-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] benzoate |
|---|---|
| PubChem CID | 162912053 |
| Molecular Formula | C22H23NO4 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.16 |
| IUPAC Name | [(1R,3R,5S,6R)-6-benzoyloxy-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] benzoate |
| SMILES | CN1[C@@H]2C[C@@H](OC(=O)c3ccccc3)C[C@H]1[C@H](OC(=O)c1ccccc1)C2 |
| InChI | InChI=1S/C22H23NO4/c1-23-17-12-18(26-21(24)15-8-4-2-5-9-15)14-19(23)20(13-17)27-22(25)16-10-6-3-7-11-16/h2-11,17-20H,12-14H2,1H3/t17-,18-,19+,20-/m1/s1 |
| InChIKey | JRPXXGFURWDPJS-YSTOQKLRSA-N |
| XLogP | 3.30 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |