C14H22O6 — CID 162912095
(5S,6S,9E,11S,14S)-5,11-dihydroxy-6,14-dimethyl-1,7-dioxacyclotetradec-9-ene-2,8-dione (PubChem CID 162912095) has the molecular formula C14H22O6 and a molecular weight of 286.32 g/mol. Its IUPAC name is (5S,6S,9E,11S,14S)-5,11-dihydroxy-6,14-dimethyl-1,7-dioxacyclotetradec-9-ene-2,8-dione.
| Compound Name | (5S,6S,9E,11S,14S)-5,11-dihydroxy-6,14-dimethyl-1,7-dioxacyclotetradec-9-ene-2,8-dione |
|---|---|
| PubChem CID | 162912095 |
| Molecular Formula | C14H22O6 |
| Molecular Weight | 286.32 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | (5S,6S,9E,11S,14S)-5,11-dihydroxy-6,14-dimethyl-1,7-dioxacyclotetradec-9-ene-2,8-dione |
| SMILES | C[C@@H]1OC(=O)/C=C/[C@@H](O)CC[C@H](C)OC(=O)CC[C@@H]1O |
| InChI | InChI=1S/C14H22O6/c1-9-3-4-11(15)5-7-14(18)20-10(2)12(16)6-8-13(17)19-9/h5,7,9-12,15-16H,3-4,6,8H2,1-2H3/b7-5+/t9-,10-,11-,12-/m0/s1 |
| InChIKey | UXOMTBTZXNATRM-HWQAPSGLSA-N |
| XLogP | 0.70 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.32 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |