C22H30N2O3 — CID 162912100
methyl 3-[(1S,8R,8aR)-8-ethyl-1'-methyl-2'-oxospiro[2,3,5,6,7,8a-hexahydroindolizine-1,3'-indole]-8-yl]propanoate (PubChem CID 162912100) has the molecular formula C22H30N2O3 and a molecular weight of 370.49 g/mol. Its IUPAC name is methyl 3-[(1S,8R,8aR)-8-ethyl-1'-methyl-2'-oxospiro[2,3,5,6,7,8a-hexahydroindolizine-1,3'-indole]-8-yl]propanoate.
| Compound Name | methyl 3-[(1S,8R,8aR)-8-ethyl-1'-methyl-2'-oxospiro[2,3,5,6,7,8a-hexahydroindolizine-1,3'-indole]-8-yl]propanoate |
|---|---|
| PubChem CID | 162912100 |
| Molecular Formula | C22H30N2O3 |
| Molecular Weight | 370.49 g/mol |
| Exact Mass | 370.23 |
| IUPAC Name | methyl 3-[(1S,8R,8aR)-8-ethyl-1'-methyl-2'-oxospiro[2,3,5,6,7,8a-hexahydroindolizine-1,3'-indole]-8-yl]propanoate |
| SMILES | CC[C@]1(CCC(=O)OC)CCCN2CC[C@@]3(C(=O)N(C)c4ccccc43)[C@H]21 |
| InChI | InChI=1S/C22H30N2O3/c1-4-21(12-10-18(25)27-3)11-7-14-24-15-13-22(19(21)24)16-8-5-6-9-17(16)23(2)20(22)26/h5-6,8-9,19H,4,7,10-15H2,1-3H3/t19-,21-,22+/m1/s1 |
| InChIKey | YARGJPJBVSIYIX-FCEUIQTBSA-N |
| XLogP | 3.12 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.49 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |