C15H22O4 — CID 162912111
[(3R,4S)-4-[(2S)-butan-2-yl]-3-hydroxy-6-oxocyclohexen-1-yl] (Z)-2-methylbut-2-enoate (PubChem CID 162912111) has the molecular formula C15H22O4 and a molecular weight of 266.34 g/mol. Its IUPAC name is [(3R,4S)-4-[(2S)-butan-2-yl]-3-hydroxy-6-oxocyclohexen-1-yl] (Z)-2-methylbut-2-enoate.
| Compound Name | [(3R,4S)-4-[(2S)-butan-2-yl]-3-hydroxy-6-oxocyclohexen-1-yl] (Z)-2-methylbut-2-enoate |
|---|---|
| PubChem CID | 162912111 |
| Molecular Formula | C15H22O4 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | [(3R,4S)-4-[(2S)-butan-2-yl]-3-hydroxy-6-oxocyclohexen-1-yl] (Z)-2-methylbut-2-enoate |
| SMILES | C/C=C(/C)C(=O)OC1=C[C@H](O)[C@H]([C@@H](C)CC)CC1=O |
| InChI | InChI=1S/C15H22O4/c1-5-9(3)11-7-13(17)14(8-12(11)16)19-15(18)10(4)6-2/h6,8-9,11-12,16H,5,7H2,1-4H3/b10-6-/t9-,11-,12-/m0/s1 |
| InChIKey | ZPCDMUKEHIEOLP-VTRHIXLQSA-N |
| XLogP | 2.38 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|