C21H28O5 — CID 162912660
(1R,8R,9S,10R,12R)-9-[2-[(2R)-2-methoxy-5-oxo-2H-furan-4-yl]ethyl]-9,10,12-trimethyl-2-oxatricyclo[6.3.1.04,12]dodec-4-en-3-one (PubChem CID 162912660) has the molecular formula C21H28O5 and a molecular weight of 360.45 g/mol. Its IUPAC name is (1R,8R,9S,10R,12R)-9-[2-[(2R)-2-methoxy-5-oxo-2H-furan-4-yl]ethyl]-9,10,12-trimethyl-2-oxatricyclo[6.3.1.04,12]dodec-4-en-3-one.
| Compound Name | (1R,8R,9S,10R,12R)-9-[2-[(2R)-2-methoxy-5-oxo-2H-furan-4-yl]ethyl]-9,10,12-trimethyl-2-oxatricyclo[6.3.1.04,12]dodec-4-en-3-one |
|---|---|
| PubChem CID | 162912660 |
| Molecular Formula | C21H28O5 |
| Molecular Weight | 360.45 g/mol |
| Exact Mass | 360.19 |
| IUPAC Name | (1R,8R,9S,10R,12R)-9-[2-[(2R)-2-methoxy-5-oxo-2H-furan-4-yl]ethyl]-9,10,12-trimethyl-2-oxatricyclo[6.3.1.04,12]dodec-4-en-3-one |
| SMILES | CO[C@H]1C=C(CC[C@@]2(C)[C@H](C)C[C@H]3OC(=O)C4=CCC[C@H]2[C@]43C)C(=O)O1 |
| InChI | InChI=1S/C21H28O5/c1-12-10-16-21(3)14(19(23)25-16)6-5-7-15(21)20(12,2)9-8-13-11-17(24-4)26-18(13)22/h6,11-12,15-17H,5,7-10H2,1-4H3/t12-,15-,16-,17-,20+,21+/m1/s1 |
| InChIKey | CLPKJMFRRPJXHG-LKUCGDGASA-N |
| XLogP | 3.54 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.45 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |