C20H26O7 — CID 162912778
[(3aR,4R,6R,10Z,11aS)-6-hydroxy-10-(hydroxymethyl)-6-methyl-3-methylidene-2,9-dioxo-3a,4,5,7,8,11a-hexahydrocyclodeca[b]furan-4-yl] (Z)-2-methylbut-2-enoate (PubChem CID 162912778) has the molecular formula C20H26O7 and a molecular weight of 378.42 g/mol. Its IUPAC name is [(3aR,4R,6R,10Z,11aS)-6-hydroxy-10-(hydroxymethyl)-6-methyl-3-methylidene-2,9-dioxo-3a,4,5,7,8,11a-hexahydrocyclodeca[b]furan-4-yl] (Z)-2-methylbut-2-enoate.
| Compound Name | [(3aR,4R,6R,10Z,11aS)-6-hydroxy-10-(hydroxymethyl)-6-methyl-3-methylidene-2,9-dioxo-3a,4,5,7,8,11a-hexahydrocyclodeca[b]furan-4-yl] (Z)-2-methylbut-2-enoate |
|---|---|
| PubChem CID | 162912778 |
| Molecular Formula | C20H26O7 |
| Molecular Weight | 378.42 g/mol |
| Exact Mass | 378.17 |
| IUPAC Name | [(3aR,4R,6R,10Z,11aS)-6-hydroxy-10-(hydroxymethyl)-6-methyl-3-methylidene-2,9-dioxo-3a,4,5,7,8,11a-hexahydrocyclodeca[b]furan-4-yl] (Z)-2-methylbut-2-enoate |
| SMILES | C=C1C(=O)O[C@H]2/C=C(/CO)C(=O)CC[C@@](C)(O)C[C@@H](OC(=O)/C(C)=C\C)[C@@H]12 |
| InChI | InChI=1S/C20H26O7/c1-5-11(2)18(23)27-16-9-20(4,25)7-6-14(22)13(10-21)8-15-17(16)12(3)19(24)26-15/h5,8,15-17,21,25H,3,6-7,9-10H2,1-2,4H3/b11-5-,13-8-/t15-,16+,17-,20+/m0/s1 |
| InChIKey | LUQDSVZBYQZSHS-ALDUMRLISA-N |
| XLogP | 1.38 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.42 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|