C28H40O10 — CID 162912830
[(1S,2R,3S,4R,7S,8Z,12S,13S,14S,16R,18S)-2,14-diacetyloxy-3-hydroxy-4,9,13,18-tetramethyl-5-oxo-6,17-dioxatetracyclo[11.5.0.03,7.016,18]octadec-8-en-12-yl] butanoate (PubChem CID 162912830) has the molecular formula C28H40O10 and a molecular weight of 536.62 g/mol. Its IUPAC name is [(1S,2R,3S,4R,7S,8Z,12S,13S,14S,16R,18S)-2,14-diacetyloxy-3-hydroxy-4,9,13,18-tetramethyl-5-oxo-6,17-dioxatetracyclo[11.5.0.03,7.016,18]octadec-8-en-12-yl] butanoate.
| Compound Name | [(1S,2R,3S,4R,7S,8Z,12S,13S,14S,16R,18S)-2,14-diacetyloxy-3-hydroxy-4,9,13,18-tetramethyl-5-oxo-6,17-dioxatetracyclo[11.5.0.03,7.016,18]octadec-8-en-12-yl] butanoate |
|---|---|
| PubChem CID | 162912830 |
| Molecular Formula | C28H40O10 |
| Molecular Weight | 536.62 g/mol |
| Exact Mass | 536.26 |
| IUPAC Name | [(1S,2R,3S,4R,7S,8Z,12S,13S,14S,16R,18S)-2,14-diacetyloxy-3-hydroxy-4,9,13,18-tetramethyl-5-oxo-6,17-dioxatetracyclo[11.5.0.03,7.016,18]octadec-8-en-12-yl] butanoate |
| SMILES | CCCC(=O)O[C@H]1CC/C(C)=C\[C@@H]2OC(=O)[C@H](C)[C@@]2(O)[C@H](OC(C)=O)[C@H]2[C@]3(C)O[C@@H]3C[C@H](OC(C)=O)[C@]12C |
| InChI | InChI=1S/C28H40O10/c1-8-9-22(31)36-18-11-10-14(2)12-21-28(33,15(3)25(32)37-21)24(35-17(5)30)23-26(18,6)19(34-16(4)29)13-20-27(23,7)38-20/h12,15,18-21,23-24,33H,8-11,13H2,1-7H3/b14-12-/t15-,18-,19-,20+,21-,23+,24+,26-,27+,28-/m0/s1 |
| InChIKey | JYKZNLVAPYOOQZ-PALROWDUSA-N |
| XLogP | 2.78 |
| TPSA | 137.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.62 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|