About (2R)-4-methyl-2-[(3S,4S)-4-methyl-5-oxooxolan-3-yl]-2H-furan-5-one
(2R)-4-methyl-2-[(3S,4S)-4-methyl-5-oxooxolan-3-yl]-2H-furan-5-one (PubChem CID 162913068) has the molecular formula C10H12O4
and a molecular weight of 196.20 g/mol. Its IUPAC name is (2R)-4-methyl-2-[(3S,4S)-4-methyl-5-oxooxolan-3-yl]-2H-furan-5-one.
Molecular Properties
| Compound Name | (2R)-4-methyl-2-[(3S,4S)-4-methyl-5-oxooxolan-3-yl]-2H-furan-5-one |
| PubChem CID | 162913068 |
| Molecular Formula | C10H12O4 |
| Molecular Weight | 196.20 g/mol |
| Exact Mass | 196.07 |
| IUPAC Name | (2R)-4-methyl-2-[(3S,4S)-4-methyl-5-oxooxolan-3-yl]-2H-furan-5-one |
| SMILES | CC1=C[C@H]([C@@H]2COC(=O)[C@H]2C)OC1=O |
| InChI | InChI=1S/C10H12O4/c1-5-3-8(14-9(5)11)7-4-13-10(12)6(7)2/h3,6-8H,4H2,1-2H3/t6-,7+,8+/m0/s1 |
| InChIKey | BABJXHCBFYMVBG-XLPZGREQSA-N |
| XLogP | 0.67 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.20 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2R)-4-methyl-2-[(3S,4S)-4-methyl-5-oxooxolan-3-yl]-2H-furan-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-4-methyl-2-[(3S,4S)-4-methyl-5-oxooxolan-3-yl]-2H-furan-5-one?
The IUPAC name of (2R)-4-methyl-2-[(3S,4S)-4-methyl-5-oxooxolan-3-yl]-2H-furan-5-one (CID 162913068) is (2R)-4-methyl-2-[(3S,4S)-4-methyl-5-oxooxolan-3-yl]-2H-furan-5-one.
What is the SMILES notation for (2R)-4-methyl-2-[(3S,4S)-4-methyl-5-oxooxolan-3-yl]-2H-furan-5-one?
The canonical SMILES for (2R)-4-methyl-2-[(3S,4S)-4-methyl-5-oxooxolan-3-yl]-2H-furan-5-one is CC1=C[C@H]([C@@H]2COC(=O)[C@H]2C)OC1=O.
What is the InChIKey of (2R)-4-methyl-2-[(3S,4S)-4-methyl-5-oxooxolan-3-yl]-2H-furan-5-one?
The InChIKey is BABJXHCBFYMVBG-XLPZGREQSA-N. The full InChI is InChI=1S/C10H12O4/c1-5-3-8(14-9(5)11)7-4-13-10(12)6(7)2/h3,6-8H,4H2,1-2H3/t6-,7+,8+/m0/s1.
What are the key properties of (2R)-4-methyl-2-[(3S,4S)-4-methyl-5-oxooxolan-3-yl]-2H-furan-5-one?
(2R)-4-methyl-2-[(3S,4S)-4-methyl-5-oxooxolan-3-yl]-2H-furan-5-one has a molecular weight of 196.20 g/mol, XLogP of 0.67, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-4-methyl-2-[(3S,4S)-4-methyl-5-oxooxolan-3-yl]-2H-furan-5-one is sourced from PubChem (CID 162913068), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).