C16H31N — CID 162913556
(5S,6R,8R,8aS)-5-butyl-6,8-diethyl-1,2,3,5,6,7,8,8a-octahydroindolizine (PubChem CID 162913556) has the molecular formula C16H31N and a molecular weight of 237.43 g/mol. Its IUPAC name is (5S,6R,8R,8aS)-5-butyl-6,8-diethyl-1,2,3,5,6,7,8,8a-octahydroindolizine.
| Compound Name | (5S,6R,8R,8aS)-5-butyl-6,8-diethyl-1,2,3,5,6,7,8,8a-octahydroindolizine |
|---|---|
| PubChem CID | 162913556 |
| Molecular Formula | C16H31N |
| Molecular Weight | 237.43 g/mol |
| Exact Mass | 237.25 |
| IUPAC Name | (5S,6R,8R,8aS)-5-butyl-6,8-diethyl-1,2,3,5,6,7,8,8a-octahydroindolizine |
| SMILES | CCCC[C@H]1[C@H](CC)C[C@@H](CC)[C@@H]2CCCN12 |
| InChI | InChI=1S/C16H31N/c1-4-7-9-15-13(5-2)12-14(6-3)16-10-8-11-17(15)16/h13-16H,4-12H2,1-3H3/t13-,14-,15+,16+/m1/s1 |
| InChIKey | FGFYXTGPWYOCEB-WCVJEAGWSA-N |
| XLogP | 4.47 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.43 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |