C22H30O2 — CID 162913578
(2R)-2-[2-[(1R)-2,2-dimethyl-6-methylidenecyclohexyl]ethyl]-2,7-dimethylchromen-5-ol (PubChem CID 162913578) has the molecular formula C22H30O2 and a molecular weight of 326.48 g/mol. Its IUPAC name is (2R)-2-[2-[(1R)-2,2-dimethyl-6-methylidenecyclohexyl]ethyl]-2,7-dimethylchromen-5-ol.
| Compound Name | (2R)-2-[2-[(1R)-2,2-dimethyl-6-methylidenecyclohexyl]ethyl]-2,7-dimethylchromen-5-ol |
|---|---|
| PubChem CID | 162913578 |
| Molecular Formula | C22H30O2 |
| Molecular Weight | 326.48 g/mol |
| Exact Mass | 326.22 |
| IUPAC Name | (2R)-2-[2-[(1R)-2,2-dimethyl-6-methylidenecyclohexyl]ethyl]-2,7-dimethylchromen-5-ol |
| SMILES | C=C1CCCC(C)(C)[C@H]1CC[C@]1(C)C=Cc2c(O)cc(C)cc2O1 |
| InChI | InChI=1S/C22H30O2/c1-15-13-19(23)17-8-11-22(5,24-20(17)14-15)12-9-18-16(2)7-6-10-21(18,3)4/h8,11,13-14,18,23H,2,6-7,9-10,12H2,1,3-5H3/t18-,22-/m0/s1 |
| InChIKey | JOKAIAHFMWOSIK-AVRDEDQJSA-N |
| XLogP | 6.03 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.48 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|