C22H34O3 — CID 162913808
[(3aR,7S,8R,8aS)-8-hydroxy-1-methyl-7-[(2R)-6-methylhept-5-en-2-yl]-3,3a,6,7,8,8a-hexahydroazulen-4-yl]methyl acetate (PubChem CID 162913808) has the molecular formula C22H34O3 and a molecular weight of 346.51 g/mol. Its IUPAC name is [(3aR,7S,8R,8aS)-8-hydroxy-1-methyl-7-[(2R)-6-methylhept-5-en-2-yl]-3,3a,6,7,8,8a-hexahydroazulen-4-yl]methyl acetate.
| Compound Name | [(3aR,7S,8R,8aS)-8-hydroxy-1-methyl-7-[(2R)-6-methylhept-5-en-2-yl]-3,3a,6,7,8,8a-hexahydroazulen-4-yl]methyl acetate |
|---|---|
| PubChem CID | 162913808 |
| Molecular Formula | C22H34O3 |
| Molecular Weight | 346.51 g/mol |
| Exact Mass | 346.25 |
| IUPAC Name | [(3aR,7S,8R,8aS)-8-hydroxy-1-methyl-7-[(2R)-6-methylhept-5-en-2-yl]-3,3a,6,7,8,8a-hexahydroazulen-4-yl]methyl acetate |
| SMILES | CC(=O)OCC1=CC[C@@H]([C@H](C)CCC=C(C)C)[C@@H](O)[C@@H]2C(C)=CC[C@@H]12 |
| InChI | InChI=1S/C22H34O3/c1-14(2)7-6-8-15(3)19-12-10-18(13-25-17(5)23)20-11-9-16(4)21(20)22(19)24/h7,9-10,15,19-22,24H,6,8,11-13H2,1-5H3/t15-,19+,20+,21-,22-/m1/s1 |
| InChIKey | JGLGOBNZXSIMNJ-MPRQEMDOSA-N |
| XLogP | 4.82 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.51 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|