C19H22O5 — CID 162914355
(2S)-2-(2-hydroxypropan-2-yl)-6-[2-[(2S)-oxiran-2-yl]propan-2-yl]-2,3-dihydrofuro[3,2-g]chromen-7-one (PubChem CID 162914355) has the molecular formula C19H22O5 and a molecular weight of 330.38 g/mol. Its IUPAC name is (2S)-2-(2-hydroxypropan-2-yl)-6-[2-[(2S)-oxiran-2-yl]propan-2-yl]-2,3-dihydrofuro[3,2-g]chromen-7-one.
| Compound Name | (2S)-2-(2-hydroxypropan-2-yl)-6-[2-[(2S)-oxiran-2-yl]propan-2-yl]-2,3-dihydrofuro[3,2-g]chromen-7-one |
|---|---|
| PubChem CID | 162914355 |
| Molecular Formula | C19H22O5 |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.15 |
| IUPAC Name | (2S)-2-(2-hydroxypropan-2-yl)-6-[2-[(2S)-oxiran-2-yl]propan-2-yl]-2,3-dihydrofuro[3,2-g]chromen-7-one |
| SMILES | CC(C)(O)[C@@H]1Cc2cc3cc(C(C)(C)[C@H]4CO4)c(=O)oc3cc2O1 |
| InChI | InChI=1S/C19H22O5/c1-18(2,16-9-22-16)12-6-10-5-11-7-15(19(3,4)21)23-13(11)8-14(10)24-17(12)20/h5-6,8,15-16,21H,7,9H2,1-4H3/t15-,16+/m0/s1 |
| InChIKey | GNKMBKJKLKPSKV-JKSUJKDBSA-N |
| XLogP | 2.54 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|