C21H34O4 — CID 162914412
[(8S,9S,11Z,14Z)-9-acetyloxyheptadeca-1,11,14-trien-8-yl] acetate (PubChem CID 162914412) has the molecular formula C21H34O4 and a molecular weight of 350.50 g/mol. Its IUPAC name is [(8S,9S,11Z,14Z)-9-acetyloxyheptadeca-1,11,14-trien-8-yl] acetate.
| Compound Name | [(8S,9S,11Z,14Z)-9-acetyloxyheptadeca-1,11,14-trien-8-yl] acetate |
|---|---|
| PubChem CID | 162914412 |
| Molecular Formula | C21H34O4 |
| Molecular Weight | 350.50 g/mol |
| Exact Mass | 350.25 |
| IUPAC Name | [(8S,9S,11Z,14Z)-9-acetyloxyheptadeca-1,11,14-trien-8-yl] acetate |
| SMILES | C=CCCCCC[C@H](OC(C)=O)[C@H](C/C=C\C/C=C\CC)OC(C)=O |
| InChI | InChI=1S/C21H34O4/c1-5-7-9-11-13-15-17-21(25-19(4)23)20(24-18(3)22)16-14-12-10-8-6-2/h6-7,9,13,15,20-21H,2,5,8,10-12,14,16-17H2,1,3-4H3/b9-7-,15-13-/t20-,21-/m0/s1 |
| InChIKey | IYBHZAIQDKSHHC-WYZRNZGCSA-N |
| XLogP | 5.29 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.50 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|