C22H36O7 — CID 162914432
[(4R,5R,6S,8R,9S)-9-acetyloxy-4,6,8-trimethyl-3,7-dioxoundecan-5-yl] (2R)-2-methyl-3-oxopentanoate (PubChem CID 162914432) has the molecular formula C22H36O7 and a molecular weight of 412.52 g/mol. Its IUPAC name is [(4R,5R,6S,8R,9S)-9-acetyloxy-4,6,8-trimethyl-3,7-dioxoundecan-5-yl] (2R)-2-methyl-3-oxopentanoate.
| Compound Name | [(4R,5R,6S,8R,9S)-9-acetyloxy-4,6,8-trimethyl-3,7-dioxoundecan-5-yl] (2R)-2-methyl-3-oxopentanoate |
|---|---|
| PubChem CID | 162914432 |
| Molecular Formula | C22H36O7 |
| Molecular Weight | 412.52 g/mol |
| Exact Mass | 412.25 |
| IUPAC Name | [(4R,5R,6S,8R,9S)-9-acetyloxy-4,6,8-trimethyl-3,7-dioxoundecan-5-yl] (2R)-2-methyl-3-oxopentanoate |
| SMILES | CCC(=O)[C@@H](C)C(=O)O[C@@H]([C@H](C)C(=O)[C@H](C)[C@H](CC)OC(C)=O)[C@@H](C)C(=O)CC |
| InChI | InChI=1S/C22H36O7/c1-9-17(24)12(4)21(29-22(27)13(5)18(25)10-2)15(7)20(26)14(6)19(11-3)28-16(8)23/h12-15,19,21H,9-11H2,1-8H3/t12-,13+,14+,15+,19-,21+/m0/s1 |
| InChIKey | BXPUQZCMXTUGDK-FRXYRZNBSA-N |
| XLogP | 3.31 |
| TPSA | 103.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.52 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|