C17H29NO2 — CID 162915606
(2R,3R,6R)-6-[(1E,3E,5R,7E)-5-hydroxydeca-1,3,7-trienyl]-1,2-dimethylpiperidin-3-ol (PubChem CID 162915606) has the molecular formula C17H29NO2 and a molecular weight of 279.42 g/mol. Its IUPAC name is (2R,3R,6R)-6-[(1E,3E,5R,7E)-5-hydroxydeca-1,3,7-trienyl]-1,2-dimethylpiperidin-3-ol.
| Compound Name | (2R,3R,6R)-6-[(1E,3E,5R,7E)-5-hydroxydeca-1,3,7-trienyl]-1,2-dimethylpiperidin-3-ol |
|---|---|
| PubChem CID | 162915606 |
| Molecular Formula | C17H29NO2 |
| Molecular Weight | 279.42 g/mol |
| Exact Mass | 279.22 |
| IUPAC Name | (2R,3R,6R)-6-[(1E,3E,5R,7E)-5-hydroxydeca-1,3,7-trienyl]-1,2-dimethylpiperidin-3-ol |
| SMILES | CC/C=C/C[C@@H](O)/C=C/C=C/[C@H]1CC[C@@H](O)[C@@H](C)N1C |
| InChI | InChI=1S/C17H29NO2/c1-4-5-6-10-16(19)11-8-7-9-15-12-13-17(20)14(2)18(15)3/h5-9,11,14-17,19-20H,4,10,12-13H2,1-3H3/b6-5+,9-7+,11-8+/t14-,15+,16-,17-/m1/s1 |
| InChIKey | SSXVPIUBXLMMTO-WBUJTVECSA-N |
| XLogP | 2.66 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.42 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|