C20H32O2 — CID 162915789
(2S,3R,3aR,6E,10E,11aS)-3,6,10-trimethyl-2-[(E)-3-methylbut-1-enyl]-3a,4,5,8,9,11a-hexahydro-3H-cyclodeca[b]furan-2-ol (PubChem CID 162915789) has the molecular formula C20H32O2 and a molecular weight of 304.47 g/mol. Its IUPAC name is (2S,3R,3aR,6E,10E,11aS)-3,6,10-trimethyl-2-[(E)-3-methylbut-1-enyl]-3a,4,5,8,9,11a-hexahydro-3H-cyclodeca[b]furan-2-ol.
| Compound Name | (2S,3R,3aR,6E,10E,11aS)-3,6,10-trimethyl-2-[(E)-3-methylbut-1-enyl]-3a,4,5,8,9,11a-hexahydro-3H-cyclodeca[b]furan-2-ol |
|---|---|
| PubChem CID | 162915789 |
| Molecular Formula | C20H32O2 |
| Molecular Weight | 304.47 g/mol |
| Exact Mass | 304.24 |
| IUPAC Name | (2S,3R,3aR,6E,10E,11aS)-3,6,10-trimethyl-2-[(E)-3-methylbut-1-enyl]-3a,4,5,8,9,11a-hexahydro-3H-cyclodeca[b]furan-2-ol |
| SMILES | C/C1=C\[C@H]2O[C@@](O)(/C=C/C(C)C)[C@H](C)[C@H]2CC/C(C)=C/CC1 |
| InChI | InChI=1S/C20H32O2/c1-14(2)11-12-20(21)17(5)18-10-9-15(3)7-6-8-16(4)13-19(18)22-20/h7,11-14,17-19,21H,6,8-10H2,1-5H3/b12-11+,15-7+,16-13+/t17-,18-,19-,20+/m1/s1 |
| InChIKey | QOSCMADTVSMJQQ-ZLBKVZQWSA-N |
| XLogP | 5.00 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.47 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|