C20H32O5 — CID 162916298
2-[(1aR,2'S,2aS,6aS,7S,7aR)-7a-(hydroxymethyl)-2',3,3,6a-tetramethylspiro[1a,2,2a,4,5,6-hexahydronaphtho[2,3-b]oxirene-7,5'-oxolane]-2'-yl]acetic acid (PubChem CID 162916298) has the molecular formula C20H32O5 and a molecular weight of 352.47 g/mol. Its IUPAC name is 2-[(1aR,2'S,2aS,6aS,7S,7aR)-7a-(hydroxymethyl)-2',3,3,6a-tetramethylspiro[1a,2,2a,4,5,6-hexahydronaphtho[2,3-b]oxirene-7,5'-oxolane]-2'-yl]acetic acid.
| Compound Name | 2-[(1aR,2'S,2aS,6aS,7S,7aR)-7a-(hydroxymethyl)-2',3,3,6a-tetramethylspiro[1a,2,2a,4,5,6-hexahydronaphtho[2,3-b]oxirene-7,5'-oxolane]-2'-yl]acetic acid |
|---|---|
| PubChem CID | 162916298 |
| Molecular Formula | C20H32O5 |
| Molecular Weight | 352.47 g/mol |
| Exact Mass | 352.22 |
| IUPAC Name | 2-[(1aR,2'S,2aS,6aS,7S,7aR)-7a-(hydroxymethyl)-2',3,3,6a-tetramethylspiro[1a,2,2a,4,5,6-hexahydronaphtho[2,3-b]oxirene-7,5'-oxolane]-2'-yl]acetic acid |
| SMILES | CC1(C)CCC[C@@]2(C)[C@H]1C[C@H]1O[C@@]1(CO)[C@]21CC[C@@](C)(CC(=O)O)O1 |
| InChI | InChI=1S/C20H32O5/c1-16(2)6-5-7-18(4)13(16)10-14-19(12-21,24-14)20(18)9-8-17(3,25-20)11-15(22)23/h13-14,21H,5-12H2,1-4H3,(H,22,23)/t13-,14+,17-,18-,19+,20-/m0/s1 |
| InChIKey | YOGHSAKMXHLZPP-FFUZVNMOSA-N |
| XLogP | 3.14 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.47 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|