C22H32O4 — CID 162916518
[(1S,2R,3R,4R)-2-(hydroxymethyl)-4-[(2Z)-6-methylhepta-2,5-dien-2-yl]-3-[(1S,2R)-2-methyl-5-oxocyclopent-3-en-1-yl]cyclopentyl] acetate (PubChem CID 162916518) has the molecular formula C22H32O4 and a molecular weight of 360.49 g/mol. Its IUPAC name is [(1S,2R,3R,4R)-2-(hydroxymethyl)-4-[(2Z)-6-methylhepta-2,5-dien-2-yl]-3-[(1S,2R)-2-methyl-5-oxocyclopent-3-en-1-yl]cyclopentyl] acetate.
| Compound Name | [(1S,2R,3R,4R)-2-(hydroxymethyl)-4-[(2Z)-6-methylhepta-2,5-dien-2-yl]-3-[(1S,2R)-2-methyl-5-oxocyclopent-3-en-1-yl]cyclopentyl] acetate |
|---|---|
| PubChem CID | 162916518 |
| Molecular Formula | C22H32O4 |
| Molecular Weight | 360.49 g/mol |
| Exact Mass | 360.23 |
| IUPAC Name | [(1S,2R,3R,4R)-2-(hydroxymethyl)-4-[(2Z)-6-methylhepta-2,5-dien-2-yl]-3-[(1S,2R)-2-methyl-5-oxocyclopent-3-en-1-yl]cyclopentyl] acetate |
| SMILES | CC(=O)O[C@H]1C[C@@H](/C(C)=C\CC=C(C)C)[C@@H]([C@H]2C(=O)C=C[C@H]2C)[C@@H]1CO |
| InChI | InChI=1S/C22H32O4/c1-13(2)7-6-8-14(3)17-11-20(26-16(5)24)18(12-23)22(17)21-15(4)9-10-19(21)25/h7-10,15,17-18,20-23H,6,11-12H2,1-5H3/b14-8-/t15-,17+,18-,20+,21-,22-/m1/s1 |
| InChIKey | WFGCKJINCFXINO-ANWKZCKOSA-N |
| XLogP | 3.86 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.49 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|