C14H16O3 — CID 162916739
(1R,2S,5R,6S,9S,10R)-5,10-dimethyl-3-oxatetracyclo[7.4.0.01,10.02,6]tridec-12-ene-4,11-dione (PubChem CID 162916739) has the molecular formula C14H16O3 and a molecular weight of 232.28 g/mol. Its IUPAC name is (1R,2S,5R,6S,9S,10R)-5,10-dimethyl-3-oxatetracyclo[7.4.0.01,10.02,6]tridec-12-ene-4,11-dione.
| Compound Name | (1R,2S,5R,6S,9S,10R)-5,10-dimethyl-3-oxatetracyclo[7.4.0.01,10.02,6]tridec-12-ene-4,11-dione |
|---|---|
| PubChem CID | 162916739 |
| Molecular Formula | C14H16O3 |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.11 |
| IUPAC Name | (1R,2S,5R,6S,9S,10R)-5,10-dimethyl-3-oxatetracyclo[7.4.0.01,10.02,6]tridec-12-ene-4,11-dione |
| SMILES | C[C@H]1C(=O)O[C@H]2[C@H]1CC[C@H]1[C@@]23C=CC(=O)[C@]13C |
| InChI | InChI=1S/C14H16O3/c1-7-8-3-4-9-13(2)10(15)5-6-14(9,13)11(8)17-12(7)16/h5-9,11H,3-4H2,1-2H3/t7-,8+,9-,11+,13+,14+/m1/s1 |
| InChIKey | KKEMJECGJYQXLI-KKERGYOBSA-N |
| XLogP | 1.72 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |