About (6-acetyloxy-5-benzoyloxycyclohexa-1,3-dien-1-yl)methyl benzoate
(6-acetyloxy-5-benzoyloxycyclohexa-1,3-dien-1-yl)methyl benzoate (PubChem CID 162917719) has the molecular formula C23H20O6
and a molecular weight of 392.41 g/mol. Its IUPAC name is (6-acetyloxy-5-benzoyloxycyclohexa-1,3-dien-1-yl)methyl benzoate.
Molecular Properties
| Compound Name | (6-acetyloxy-5-benzoyloxycyclohexa-1,3-dien-1-yl)methyl benzoate |
| PubChem CID | 162917719 |
| Molecular Formula | C23H20O6 |
| Molecular Weight | 392.41 g/mol |
| Exact Mass | 392.13 |
| IUPAC Name | (6-acetyloxy-5-benzoyloxycyclohexa-1,3-dien-1-yl)methyl benzoate |
| SMILES | CC(=O)OC1C(COC(=O)c2ccccc2)=CC=CC1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C23H20O6/c1-16(24)28-21-19(15-27-22(25)17-9-4-2-5-10-17)13-8-14-20(21)29-23(26)18-11-6-3-7-12-18/h2-14,20-21H,15H2,1H3 |
| InChIKey | ZBHLLVTXWGMEMT-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 392.41 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|
Analyze (6-acetyloxy-5-benzoyloxycyclohexa-1,3-dien-1-yl)methyl benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-acetyloxy-5-benzoyloxycyclohexa-1,3-dien-1-yl)methyl benzoate?
The IUPAC name of (6-acetyloxy-5-benzoyloxycyclohexa-1,3-dien-1-yl)methyl benzoate (CID 162917719) is (6-acetyloxy-5-benzoyloxycyclohexa-1,3-dien-1-yl)methyl benzoate.
What is the SMILES notation for (6-acetyloxy-5-benzoyloxycyclohexa-1,3-dien-1-yl)methyl benzoate?
The canonical SMILES for (6-acetyloxy-5-benzoyloxycyclohexa-1,3-dien-1-yl)methyl benzoate is CC(=O)OC1C(COC(=O)c2ccccc2)=CC=CC1OC(=O)c1ccccc1.
What is the InChIKey of (6-acetyloxy-5-benzoyloxycyclohexa-1,3-dien-1-yl)methyl benzoate?
The InChIKey is ZBHLLVTXWGMEMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H20O6/c1-16(24)28-21-19(15-27-22(25)17-9-4-2-5-10-17)13-8-14-20(21)29-23(26)18-11-6-3-7-12-18/h2-14,20-21H,15H2,1H3.
What are the key properties of (6-acetyloxy-5-benzoyloxycyclohexa-1,3-dien-1-yl)methyl benzoate?
(6-acetyloxy-5-benzoyloxycyclohexa-1,3-dien-1-yl)methyl benzoate has a molecular weight of 392.41 g/mol, XLogP of 3.50, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (6-acetyloxy-5-benzoyloxycyclohexa-1,3-dien-1-yl)methyl benzoate is sourced from PubChem (CID 162917719), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).