C21H27NO2 — CID 162917875
(1R,2S,3R,5R,6S,10S,16R,19R)-2,6-dimethyl-8-azahexacyclo[11.5.1.11,5.02,10.03,8.016,19]icos-13-ene-15,20-dione (PubChem CID 162917875) has the molecular formula C21H27NO2 and a molecular weight of 325.45 g/mol. Its IUPAC name is (1R,2S,3R,5R,6S,10S,16R,19R)-2,6-dimethyl-8-azahexacyclo[11.5.1.11,5.02,10.03,8.016,19]icos-13-ene-15,20-dione.
| Compound Name | (1R,2S,3R,5R,6S,10S,16R,19R)-2,6-dimethyl-8-azahexacyclo[11.5.1.11,5.02,10.03,8.016,19]icos-13-ene-15,20-dione |
|---|---|
| PubChem CID | 162917875 |
| Molecular Formula | C21H27NO2 |
| Molecular Weight | 325.45 g/mol |
| Exact Mass | 325.20 |
| IUPAC Name | (1R,2S,3R,5R,6S,10S,16R,19R)-2,6-dimethyl-8-azahexacyclo[11.5.1.11,5.02,10.03,8.016,19]icos-13-ene-15,20-dione |
| SMILES | C[C@@H]1CN2C[C@H]3CCC4=CC(=O)[C@@H]5CC[C@@]6(C(=O)[C@@H]1C[C@@H]2[C@@]36C)[C@@H]45 |
| InChI | InChI=1S/C21H27NO2/c1-11-9-22-10-13-4-3-12-7-16(23)14-5-6-21(18(12)14)19(24)15(11)8-17(22)20(13,21)2/h7,11,13-15,17-18H,3-6,8-10H2,1-2H3/t11-,13-,14+,15-,17-,18+,20-,21+/m1/s1 |
| InChIKey | FFPIZGFBLZMIAW-DOWKDYKNSA-N |
| XLogP | 2.85 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.45 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |