C21H20O5 — CID 162917914
2-(3,5-dimethoxyphenyl)-8-methyl-7,10-dihydrofuro[2,3-g][1]benzoxepin-5-ol (PubChem CID 162917914) has the molecular formula C21H20O5 and a molecular weight of 352.39 g/mol. Its IUPAC name is 2-(3,5-dimethoxyphenyl)-8-methyl-7,10-dihydrofuro[2,3-g][1]benzoxepin-5-ol.
| Compound Name | 2-(3,5-dimethoxyphenyl)-8-methyl-7,10-dihydrofuro[2,3-g][1]benzoxepin-5-ol |
|---|---|
| PubChem CID | 162917914 |
| Molecular Formula | C21H20O5 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.13 |
| IUPAC Name | 2-(3,5-dimethoxyphenyl)-8-methyl-7,10-dihydrofuro[2,3-g][1]benzoxepin-5-ol |
| SMILES | COc1cc(OC)cc(-c2cc3cc(O)c4c(c3o2)CC=C(C)CO4)c1 |
| InChI | InChI=1S/C21H20O5/c1-12-4-5-17-20-14(8-18(22)21(17)25-11-12)9-19(26-20)13-6-15(23-2)10-16(7-13)24-3/h4,6-10,22H,5,11H2,1-3H3 |
| InChIKey | QNMIYQNVWMSFMF-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 61.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|