C15H24O3 — CID 162918249
1-[(1aR,2R,3aS,4R,6aR,6bS)-2-hydroxy-1a,4-dimethyl-3,3a,4,5,6,6b-hexahydro-2H-indeno[4,5-b]oxiren-6a-yl]-2-methylpropan-1-one (PubChem CID 162918249) has the molecular formula C15H24O3 and a molecular weight of 252.35 g/mol. Its IUPAC name is 1-[(1aR,2R,3aS,4R,6aR,6bS)-2-hydroxy-1a,4-dimethyl-3,3a,4,5,6,6b-hexahydro-2H-indeno[4,5-b]oxiren-6a-yl]-2-methylpropan-1-one.
| Compound Name | 1-[(1aR,2R,3aS,4R,6aR,6bS)-2-hydroxy-1a,4-dimethyl-3,3a,4,5,6,6b-hexahydro-2H-indeno[4,5-b]oxiren-6a-yl]-2-methylpropan-1-one |
|---|---|
| PubChem CID | 162918249 |
| Molecular Formula | C15H24O3 |
| Molecular Weight | 252.35 g/mol |
| Exact Mass | 252.17 |
| IUPAC Name | 1-[(1aR,2R,3aS,4R,6aR,6bS)-2-hydroxy-1a,4-dimethyl-3,3a,4,5,6,6b-hexahydro-2H-indeno[4,5-b]oxiren-6a-yl]-2-methylpropan-1-one |
| SMILES | CC(C)C(=O)[C@]12CC[C@@H](C)[C@@H]1C[C@@H](O)[C@@]1(C)O[C@H]12 |
| InChI | InChI=1S/C15H24O3/c1-8(2)12(17)15-6-5-9(3)10(15)7-11(16)14(4)13(15)18-14/h8-11,13,16H,5-7H2,1-4H3/t9-,10+,11-,13-,14-,15+/m1/s1 |
| InChIKey | LYIWLJIKHQNNCM-FRFSUOBISA-N |
| XLogP | 2.17 |
| TPSA | 49.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.35 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|