C27H22O15 — CID 162918355
[3-[(2S,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]oxy-2-(3,4-dihydroxyphenyl)-7-hydroxy-4-oxochromen-5-yl] 3,4,5-trihydroxybenzoate (PubChem CID 162918355) has the molecular formula C27H22O15 and a molecular weight of 586.46 g/mol. Its IUPAC name is [3-[(2S,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]oxy-2-(3,4-dihydroxyphenyl)-7-hydroxy-4-oxochromen-5-yl] 3,4,5-trihydroxybenzoate.
| Compound Name | [3-[(2S,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]oxy-2-(3,4-dihydroxyphenyl)-7-hydroxy-4-oxochromen-5-yl] 3,4,5-trihydroxybenzoate |
|---|---|
| PubChem CID | 162918355 |
| Molecular Formula | C27H22O15 |
| Molecular Weight | 586.46 g/mol |
| Exact Mass | 586.10 |
| IUPAC Name | [3-[(2S,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]oxy-2-(3,4-dihydroxyphenyl)-7-hydroxy-4-oxochromen-5-yl] 3,4,5-trihydroxybenzoate |
| SMILES | O=C(Oc1cc(O)cc2oc(-c3ccc(O)c(O)c3)c(O[C@@H]3O[C@H](CO)[C@@H](O)[C@H]3O)c(=O)c12)c1cc(O)c(O)c(O)c1 |
| InChI | InChI=1S/C27H22O15/c28-8-18-21(35)23(37)27(41-18)42-25-22(36)19-16(39-24(25)9-1-2-12(30)13(31)3-9)6-11(29)7-17(19)40-26(38)10-4-14(32)20(34)15(33)5-10/h1-7,18,21,23,27-35,37H,8H2/t18-,21-,23-,27+/m1/s1 |
| InChIKey | LFQZCBSAAFCIGV-PAUHDODLSA-N |
| XLogP | 0.73 |
| TPSA | 257.04 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.46 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|