C24H28N2O7 — CID 162919117
(1S,6R,8R,11R,23S,24R,25S)-23-hydroxy-17,18-dimethoxy-4-methyl-7,10-dioxa-4,14-diazaheptacyclo[12.6.5.01,25.06,8.06,23.011,24.015,20]pentacosa-15,17,19-triene-13,21-dione (PubChem CID 162919117) has the molecular formula C24H28N2O7 and a molecular weight of 456.50 g/mol. Its IUPAC name is (1S,6R,8R,11R,23S,24R,25S)-23-hydroxy-17,18-dimethoxy-4-methyl-7,10-dioxa-4,14-diazaheptacyclo[12.6.5.01,25.06,8.06,23.011,24.015,20]pentacosa-15,17,19-triene-13,21-dione.
| Compound Name | (1S,6R,8R,11R,23S,24R,25S)-23-hydroxy-17,18-dimethoxy-4-methyl-7,10-dioxa-4,14-diazaheptacyclo[12.6.5.01,25.06,8.06,23.011,24.015,20]pentacosa-15,17,19-triene-13,21-dione |
|---|---|
| PubChem CID | 162919117 |
| Molecular Formula | C24H28N2O7 |
| Molecular Weight | 456.50 g/mol |
| Exact Mass | 456.19 |
| IUPAC Name | (1S,6R,8R,11R,23S,24R,25S)-23-hydroxy-17,18-dimethoxy-4-methyl-7,10-dioxa-4,14-diazaheptacyclo[12.6.5.01,25.06,8.06,23.011,24.015,20]pentacosa-15,17,19-triene-13,21-dione |
| SMILES | COc1cc2c(cc1OC)[C@@]13CCN(C)C[C@@]45O[C@@H]4CO[C@@H]4CC(=O)N2[C@H]1[C@H]4[C@@]5(O)CC3=O |
| InChI | InChI=1S/C24H28N2O7/c1-25-5-4-22-12-6-14(30-2)15(31-3)7-13(12)26-19(28)8-16-20(21(22)26)23(29,9-17(22)27)24(11-25)18(33-24)10-32-16/h6-7,16,18,20-21,29H,4-5,8-11H2,1-3H3/t16-,18-,20+,21+,22-,23+,24-/m1/s1 |
| InChIKey | JLIIYLZAZQFIFD-YFNXRGSLSA-N |
| XLogP | 0.25 |
| TPSA | 101.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.50 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|