C35H42N2O5 — CID 162919725
1-[4-hydroxy-3-[2-[4-hydroxy-2-[7-(hydroxymethyl)-1H-indol-5-yl]phenyl]ethoxy]phenyl]-11-(methylamino)undec-4-en-3-one (PubChem CID 162919725) has the molecular formula C35H42N2O5 and a molecular weight of 570.73 g/mol. Its IUPAC name is 1-[4-hydroxy-3-[2-[4-hydroxy-2-[7-(hydroxymethyl)-1H-indol-5-yl]phenyl]ethoxy]phenyl]-11-(methylamino)undec-4-en-3-one.
| Compound Name | 1-[4-hydroxy-3-[2-[4-hydroxy-2-[7-(hydroxymethyl)-1H-indol-5-yl]phenyl]ethoxy]phenyl]-11-(methylamino)undec-4-en-3-one |
|---|---|
| PubChem CID | 162919725 |
| Molecular Formula | C35H42N2O5 |
| Molecular Weight | 570.73 g/mol |
| Exact Mass | 570.31 |
| IUPAC Name | 1-[4-hydroxy-3-[2-[4-hydroxy-2-[7-(hydroxymethyl)-1H-indol-5-yl]phenyl]ethoxy]phenyl]-11-(methylamino)undec-4-en-3-one |
| SMILES | CNCCCCCCC=CC(=O)CCc1ccc(O)c(OCCc2ccc(O)cc2-c2cc(CO)c3[nH]ccc3c2)c1 |
| InChI | InChI=1S/C35H42N2O5/c1-36-17-7-5-3-2-4-6-8-30(39)12-9-25-10-14-33(41)34(20-25)42-19-16-26-11-13-31(40)23-32(26)28-21-27-15-18-37-35(27)29(22-28)24-38/h6,8,10-11,13-15,18,20-23,36-38,40-41H,2-5,7,9,12,16-17,19,24H2,1H3 |
| InChIKey | NWTXRAIXCRQDEI-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 114.81 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.73 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|