C21H30O4 — CID 162919843
(4E,4aS,7E,9S,11aR)-9-hydroxy-4-[(E)-4-methoxy-4-methylpent-2-enylidene]-7-methyl-11-methylidene-4a,5,6,9,10,11a-hexahydro-1H-cyclonona[c]pyran-3-one (PubChem CID 162919843) has the molecular formula C21H30O4 and a molecular weight of 346.47 g/mol. Its IUPAC name is (4E,4aS,7E,9S,11aR)-9-hydroxy-4-[(E)-4-methoxy-4-methylpent-2-enylidene]-7-methyl-11-methylidene-4a,5,6,9,10,11a-hexahydro-1H-cyclonona[c]pyran-3-one.
| Compound Name | (4E,4aS,7E,9S,11aR)-9-hydroxy-4-[(E)-4-methoxy-4-methylpent-2-enylidene]-7-methyl-11-methylidene-4a,5,6,9,10,11a-hexahydro-1H-cyclonona[c]pyran-3-one |
|---|---|
| PubChem CID | 162919843 |
| Molecular Formula | C21H30O4 |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.21 |
| IUPAC Name | (4E,4aS,7E,9S,11aR)-9-hydroxy-4-[(E)-4-methoxy-4-methylpent-2-enylidene]-7-methyl-11-methylidene-4a,5,6,9,10,11a-hexahydro-1H-cyclonona[c]pyran-3-one |
| SMILES | C=C1C[C@H](O)/C=C(\C)CC[C@@H]2/C(=C\C=C\C(C)(C)OC)C(=O)OC[C@@H]12 |
| InChI | InChI=1S/C21H30O4/c1-14-8-9-17-18(7-6-10-21(3,4)24-5)20(23)25-13-19(17)15(2)12-16(22)11-14/h6-7,10-11,16-17,19,22H,2,8-9,12-13H2,1,3-5H3/b10-6+,14-11+,18-7+/t16-,17-,19+/m1/s1 |
| InChIKey | RKOBBABXXJPAJT-HFVKXEKTSA-N |
| XLogP | 3.73 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|