C19H30O4 — CID 162919891
methyl (2Z)-2-[(5S)-3,5-diethyl-5-[(E,2S,5S)-2-ethyl-5-hydroxyhex-3-enyl]furan-2-ylidene]acetate (PubChem CID 162919891) has the molecular formula C19H30O4 and a molecular weight of 322.45 g/mol. Its IUPAC name is methyl (2Z)-2-[(5S)-3,5-diethyl-5-[(E,2S,5S)-2-ethyl-5-hydroxyhex-3-enyl]furan-2-ylidene]acetate.
| Compound Name | methyl (2Z)-2-[(5S)-3,5-diethyl-5-[(E,2S,5S)-2-ethyl-5-hydroxyhex-3-enyl]furan-2-ylidene]acetate |
|---|---|
| PubChem CID | 162919891 |
| Molecular Formula | C19H30O4 |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.21 |
| IUPAC Name | methyl (2Z)-2-[(5S)-3,5-diethyl-5-[(E,2S,5S)-2-ethyl-5-hydroxyhex-3-enyl]furan-2-ylidene]acetate |
| SMILES | CCC1=C[C@](CC)(C[C@@H](/C=C/[C@H](C)O)CC)O/C1=C\C(=O)OC |
| InChI | InChI=1S/C19H30O4/c1-6-15(10-9-14(4)20)12-19(8-3)13-16(7-2)17(23-19)11-18(21)22-5/h9-11,13-15,20H,6-8,12H2,1-5H3/b10-9+,17-11-/t14-,15+,19-/m0/s1 |
| InChIKey | YNPVSGZQMXBKIO-VMDVTJIASA-N |
| XLogP | 3.91 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|