C16H21ClO10 — CID 162920006
methyl (3S,4R,5S,6S)-6-[(1S,2S,5S,6R)-2-chloro-5,6-dihydroxy-3-methoxycarbonylcyclohex-3-en-1-yl]oxy-3,4,5-trihydroxycyclohexene-1-carboxylate (PubChem CID 162920006) has the molecular formula C16H21ClO10 and a molecular weight of 408.79 g/mol. Its IUPAC name is methyl (3S,4R,5S,6S)-6-[(1S,2S,5S,6R)-2-chloro-5,6-dihydroxy-3-methoxycarbonylcyclohex-3-en-1-yl]oxy-3,4,5-trihydroxycyclohexene-1-carboxylate.
| Compound Name | methyl (3S,4R,5S,6S)-6-[(1S,2S,5S,6R)-2-chloro-5,6-dihydroxy-3-methoxycarbonylcyclohex-3-en-1-yl]oxy-3,4,5-trihydroxycyclohexene-1-carboxylate |
|---|---|
| PubChem CID | 162920006 |
| Molecular Formula | C16H21ClO10 |
| Molecular Weight | 408.79 g/mol |
| Exact Mass | 408.08 |
| IUPAC Name | methyl (3S,4R,5S,6S)-6-[(1S,2S,5S,6R)-2-chloro-5,6-dihydroxy-3-methoxycarbonylcyclohex-3-en-1-yl]oxy-3,4,5-trihydroxycyclohexene-1-carboxylate |
| SMILES | COC(=O)C1=C[C@H](O)[C@@H](O)[C@H](O[C@H]2C(C(=O)OC)=C[C@H](O)[C@@H](O)[C@@H]2O)[C@H]1Cl |
| InChI | InChI=1S/C16H21ClO10/c1-25-15(23)5-3-8(19)11(21)14(9(5)17)27-13-6(16(24)26-2)4-7(18)10(20)12(13)22/h3-4,7-14,18-22H,1-2H3/t7-,8-,9-,10+,11+,12-,13-,14+/m0/s1 |
| InChIKey | ASEVULJAKVHVDT-ZOGIQTLHSA-N |
| XLogP | -2.62 |
| TPSA | 162.98 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.79 |
| LogP ≤ 5 | -2.62 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|