C24H34O7 — CID 162920295
dimethyl (1Z,5Z,7R,9E,11E,14R)-7-acetyloxy-14-hydroxy-9-methyl-12-propan-2-ylcyclotetradeca-1,5,9,11-tetraene-1,5-dicarboxylate (PubChem CID 162920295) has the molecular formula C24H34O7 and a molecular weight of 434.53 g/mol. Its IUPAC name is dimethyl (1Z,5Z,7R,9E,11E,14R)-7-acetyloxy-14-hydroxy-9-methyl-12-propan-2-ylcyclotetradeca-1,5,9,11-tetraene-1,5-dicarboxylate.
| Compound Name | dimethyl (1Z,5Z,7R,9E,11E,14R)-7-acetyloxy-14-hydroxy-9-methyl-12-propan-2-ylcyclotetradeca-1,5,9,11-tetraene-1,5-dicarboxylate |
|---|---|
| PubChem CID | 162920295 |
| Molecular Formula | C24H34O7 |
| Molecular Weight | 434.53 g/mol |
| Exact Mass | 434.23 |
| IUPAC Name | dimethyl (1Z,5Z,7R,9E,11E,14R)-7-acetyloxy-14-hydroxy-9-methyl-12-propan-2-ylcyclotetradeca-1,5,9,11-tetraene-1,5-dicarboxylate |
| SMILES | COC(=O)/C1=C\[C@H](OC(C)=O)C/C(C)=C/C=C(/C(C)C)C[C@@H](O)/C(C(=O)OC)=C/CC1 |
| InChI | InChI=1S/C24H34O7/c1-15(2)18-11-10-16(3)12-20(31-17(4)25)13-19(23(27)29-5)8-7-9-21(22(26)14-18)24(28)30-6/h9-11,13,15,20,22,26H,7-8,12,14H2,1-6H3/b16-10+,18-11+,19-13-,21-9-/t20-,22-/m1/s1 |
| InChIKey | KBQKZBYGDQCBTJ-NPVOAUDJSA-N |
| XLogP | 3.58 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.53 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|