C15H18O5 — CID 162920444
(9R,10E,11aR)-9-hydroxy-3-(hydroxymethyl)-10-methyl-6-methylidene-5,8,9,11a-tetrahydro-4H-cyclodeca[b]furan-2,7-dione (PubChem CID 162920444) has the molecular formula C15H18O5 and a molecular weight of 278.30 g/mol. Its IUPAC name is (9R,10E,11aR)-9-hydroxy-3-(hydroxymethyl)-10-methyl-6-methylidene-5,8,9,11a-tetrahydro-4H-cyclodeca[b]furan-2,7-dione.
| Compound Name | (9R,10E,11aR)-9-hydroxy-3-(hydroxymethyl)-10-methyl-6-methylidene-5,8,9,11a-tetrahydro-4H-cyclodeca[b]furan-2,7-dione |
|---|---|
| PubChem CID | 162920444 |
| Molecular Formula | C15H18O5 |
| Molecular Weight | 278.30 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | (9R,10E,11aR)-9-hydroxy-3-(hydroxymethyl)-10-methyl-6-methylidene-5,8,9,11a-tetrahydro-4H-cyclodeca[b]furan-2,7-dione |
| SMILES | C=C1CCC2=C(CO)C(=O)O[C@@H]2/C=C(\C)[C@H](O)CC1=O |
| InChI | InChI=1S/C15H18O5/c1-8-3-4-10-11(7-16)15(19)20-14(10)5-9(2)13(18)6-12(8)17/h5,13-14,16,18H,1,3-4,6-7H2,2H3/b9-5+/t13-,14-/m1/s1 |
| InChIKey | DLMKPBDNRSJGBM-KEGUIYOVSA-N |
| XLogP | 0.82 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.30 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|