C15H14O3 — CID 162920920
1-hydroxytrideca-3,11-dien-5,7,9-triyn-2-yl acetate (PubChem CID 162920920) has the molecular formula C15H14O3 and a molecular weight of 242.27 g/mol. Its IUPAC name is 1-hydroxytrideca-3,11-dien-5,7,9-triyn-2-yl acetate.
| Compound Name | 1-hydroxytrideca-3,11-dien-5,7,9-triyn-2-yl acetate |
|---|---|
| PubChem CID | 162920920 |
| Molecular Formula | C15H14O3 |
| Molecular Weight | 242.27 g/mol |
| Exact Mass | 242.09 |
| IUPAC Name | 1-hydroxytrideca-3,11-dien-5,7,9-triyn-2-yl acetate |
| SMILES | CC=CC#CC#CC#CC=CC(CO)OC(C)=O |
| InChI | InChI=1S/C15H14O3/c1-3-4-5-6-7-8-9-10-11-12-15(13-16)18-14(2)17/h3-4,11-12,15-16H,13H2,1-2H3 |
| InChIKey | WKRNHBCXIBQLQB-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.27 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|