C17H22O5 — CID 162920942
(4,8-dimethyl-12-methylidene-13-oxo-3,14-dioxatricyclo[9.3.0.02,4]tetradec-7-en-5-yl) acetate (PubChem CID 162920942) has the molecular formula C17H22O5 and a molecular weight of 306.36 g/mol. Its IUPAC name is (4,8-dimethyl-12-methylidene-13-oxo-3,14-dioxatricyclo[9.3.0.02,4]tetradec-7-en-5-yl) acetate.
| Compound Name | (4,8-dimethyl-12-methylidene-13-oxo-3,14-dioxatricyclo[9.3.0.02,4]tetradec-7-en-5-yl) acetate |
|---|---|
| PubChem CID | 162920942 |
| Molecular Formula | C17H22O5 |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.15 |
| IUPAC Name | (4,8-dimethyl-12-methylidene-13-oxo-3,14-dioxatricyclo[9.3.0.02,4]tetradec-7-en-5-yl) acetate |
| SMILES | C=C1C(=O)OC2C1CCC(C)=CCC(OC(C)=O)C1(C)OC21 |
| InChI | InChI=1S/C17H22O5/c1-9-5-7-12-10(2)16(19)21-14(12)15-17(4,22-15)13(8-6-9)20-11(3)18/h6,12-15H,2,5,7-8H2,1,3-4H3 |
| InChIKey | UFLVRHJRHVNOQO-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 65.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|