C32H26O7 — CID 162921126
9-methoxy-3-[[(15S)-8-methoxy-6-methyl-10,14-dioxatetracyclo[7.6.1.02,7.012,16]hexadeca-1(16),2,4,6,8,11-hexaen-15-yl]oxymethyl]-8-methylbenzo[f][1]benzofuran-4-carbaldehyde (PubChem CID 162921126) has the molecular formula C32H26O7 and a molecular weight of 522.55 g/mol. Its IUPAC name is 9-methoxy-3-[[(15S)-8-methoxy-6-methyl-10,14-dioxatetracyclo[7.6.1.02,7.012,16]hexadeca-1(16),2,4,6,8,11-hexaen-15-yl]oxymethyl]-8-methylbenzo[f][1]benzofuran-4-carbaldehyde.
| Compound Name | 9-methoxy-3-[[(15S)-8-methoxy-6-methyl-10,14-dioxatetracyclo[7.6.1.02,7.012,16]hexadeca-1(16),2,4,6,8,11-hexaen-15-yl]oxymethyl]-8-methylbenzo[f][1]benzofuran-4-carbaldehyde |
|---|---|
| PubChem CID | 162921126 |
| Molecular Formula | C32H26O7 |
| Molecular Weight | 522.55 g/mol |
| Exact Mass | 522.17 |
| IUPAC Name | 9-methoxy-3-[[(15S)-8-methoxy-6-methyl-10,14-dioxatetracyclo[7.6.1.02,7.012,16]hexadeca-1(16),2,4,6,8,11-hexaen-15-yl]oxymethyl]-8-methylbenzo[f][1]benzofuran-4-carbaldehyde |
| SMILES | COc1c2occ(CO[C@@H]3OCc4coc5c(OC)c6c(C)cccc6c3c45)c2c(C=O)c2cccc(C)c12 |
| InChI | InChI=1S/C32H26O7/c1-16-7-5-9-20-22(11-33)25-18(12-36-30(25)28(34-3)23(16)20)14-38-32-27-21-10-6-8-17(2)24(21)29(35-4)31-26(27)19(13-37-31)15-39-32/h5-13,32H,14-15H2,1-4H3/t32-/m1/s1 |
| InChIKey | VPLKLUQNJXOYEG-JGCGQSQUSA-N |
| XLogP | 7.68 |
| TPSA | 80.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.55 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|