C15H16O7 — CID 162921237
methyl (1S,4aS,7R,7aS)-1-hydroxy-4'-[(1S)-1-hydroxyethyl]-5'-oxospiro[4a,7a-dihydro-1H-cyclopenta[c]pyran-7,2'-furan]-4-carboxylate (PubChem CID 162921237) has the molecular formula C15H16O7 and a molecular weight of 308.29 g/mol. Its IUPAC name is methyl (1S,4aS,7R,7aS)-1-hydroxy-4'-[(1S)-1-hydroxyethyl]-5'-oxospiro[4a,7a-dihydro-1H-cyclopenta[c]pyran-7,2'-furan]-4-carboxylate.
| Compound Name | methyl (1S,4aS,7R,7aS)-1-hydroxy-4'-[(1S)-1-hydroxyethyl]-5'-oxospiro[4a,7a-dihydro-1H-cyclopenta[c]pyran-7,2'-furan]-4-carboxylate |
|---|---|
| PubChem CID | 162921237 |
| Molecular Formula | C15H16O7 |
| Molecular Weight | 308.29 g/mol |
| Exact Mass | 308.09 |
| IUPAC Name | methyl (1S,4aS,7R,7aS)-1-hydroxy-4'-[(1S)-1-hydroxyethyl]-5'-oxospiro[4a,7a-dihydro-1H-cyclopenta[c]pyran-7,2'-furan]-4-carboxylate |
| SMILES | COC(=O)C1=CO[C@H](O)[C@H]2[C@@H]1C=C[C@@]21C=C([C@H](C)O)C(=O)O1 |
| InChI | InChI=1S/C15H16O7/c1-7(16)9-5-15(22-13(9)18)4-3-8-10(12(17)20-2)6-21-14(19)11(8)15/h3-8,11,14,16,19H,1-2H3/t7-,8+,11+,14-,15+/m0/s1 |
| InChIKey | OUOSHWYSMWEYBM-IUMKYAOKSA-N |
| XLogP | -0.20 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.29 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|