C27H37Cl2NO2 — CID 162921738
(5R,8S,9S,10S,13R,14R,17R)-17-[[(3,5-dichloro-2-hydroxyphenyl)methylideneamino]methyl]-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-ol (PubChem CID 162921738) has the molecular formula C27H37Cl2NO2 and a molecular weight of 478.50 g/mol. Its IUPAC name is (5R,8S,9S,10S,13R,14R,17R)-17-[[(3,5-dichloro-2-hydroxyphenyl)methylideneamino]methyl]-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-ol.
| Compound Name | (5R,8S,9S,10S,13R,14R,17R)-17-[[(3,5-dichloro-2-hydroxyphenyl)methylideneamino]methyl]-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-ol |
|---|---|
| PubChem CID | 162921738 |
| Molecular Formula | C27H37Cl2NO2 |
| Molecular Weight | 478.50 g/mol |
| Exact Mass | 477.22 |
| IUPAC Name | (5R,8S,9S,10S,13R,14R,17R)-17-[[(3,5-dichloro-2-hydroxyphenyl)methylideneamino]methyl]-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-ol |
| SMILES | C[C@]12CCCC[C@@H]1CC[C@@H]1[C@H]3CC[C@](O)(C/N=C/c4cc(Cl)cc(Cl)c4O)[C@]3(C)CC[C@@H]12 |
| InChI | InChI=1S/C27H37Cl2NO2/c1-25-10-4-3-5-18(25)6-7-20-21(25)8-11-26(2)22(20)9-12-27(26,32)16-30-15-17-13-19(28)14-23(29)24(17)31/h13-15,18,20-22,31-32H,3-12,16H2,1-2H3/b30-15+/t18-,20+,21+,22-,25+,26-,27+/m1/s1 |
| InChIKey | OAALXLVVEQAVAA-HWCXKMOBSA-N |
| XLogP | 7.28 |
| TPSA | 52.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.50 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|