C28H24O7 — CID 162922054
5-[(2S,3R,4R,5S)-4-(3,5-dihydroxyphenyl)-2,5-bis(4-hydroxyphenyl)oxolan-3-yl]benzene-1,3-diol (PubChem CID 162922054) has the molecular formula C28H24O7 and a molecular weight of 472.49 g/mol. Its IUPAC name is 5-[(2S,3R,4R,5S)-4-(3,5-dihydroxyphenyl)-2,5-bis(4-hydroxyphenyl)oxolan-3-yl]benzene-1,3-diol.
| Compound Name | 5-[(2S,3R,4R,5S)-4-(3,5-dihydroxyphenyl)-2,5-bis(4-hydroxyphenyl)oxolan-3-yl]benzene-1,3-diol |
|---|---|
| PubChem CID | 162922054 |
| Molecular Formula | C28H24O7 |
| Molecular Weight | 472.49 g/mol |
| Exact Mass | 472.15 |
| IUPAC Name | 5-[(2S,3R,4R,5S)-4-(3,5-dihydroxyphenyl)-2,5-bis(4-hydroxyphenyl)oxolan-3-yl]benzene-1,3-diol |
| SMILES | Oc1ccc([C@H]2O[C@H](c3ccc(O)cc3)[C@@H](c3cc(O)cc(O)c3)[C@@H]2c2cc(O)cc(O)c2)cc1 |
| InChI | InChI=1S/C28H24O7/c29-19-5-1-15(2-6-19)27-25(17-9-21(31)13-22(32)10-17)26(18-11-23(33)14-24(34)12-18)28(35-27)16-3-7-20(30)8-4-16/h1-14,25-34H/t25-,26-,27+,28+/m0/s1 |
| InChIKey | IRMTUHFNJGIEEV-YVHASNINSA-N |
| XLogP | 5.30 |
| TPSA | 130.61 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.49 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |