C24H32N2O4 — CID 162922436
methyl 2-[(1S,9S,12S,19S)-6-methoxy-8-propanoyl-8,16-diazapentacyclo[10.6.1.01,9.02,7.016,19]nonadeca-2(7),3,5-trien-12-yl]acetate (PubChem CID 162922436) has the molecular formula C24H32N2O4 and a molecular weight of 412.53 g/mol. Its IUPAC name is methyl 2-[(1S,9S,12S,19S)-6-methoxy-8-propanoyl-8,16-diazapentacyclo[10.6.1.01,9.02,7.016,19]nonadeca-2(7),3,5-trien-12-yl]acetate.
| Compound Name | methyl 2-[(1S,9S,12S,19S)-6-methoxy-8-propanoyl-8,16-diazapentacyclo[10.6.1.01,9.02,7.016,19]nonadeca-2(7),3,5-trien-12-yl]acetate |
|---|---|
| PubChem CID | 162922436 |
| Molecular Formula | C24H32N2O4 |
| Molecular Weight | 412.53 g/mol |
| Exact Mass | 412.24 |
| IUPAC Name | methyl 2-[(1S,9S,12S,19S)-6-methoxy-8-propanoyl-8,16-diazapentacyclo[10.6.1.01,9.02,7.016,19]nonadeca-2(7),3,5-trien-12-yl]acetate |
| SMILES | CCC(=O)N1c2c(OC)cccc2[C@@]23CCN4CCC[C@@](CC(=O)OC)(CC[C@H]12)[C@H]43 |
| InChI | InChI=1S/C24H32N2O4/c1-4-19(27)26-18-9-11-23(15-20(28)30-3)10-6-13-25-14-12-24(18,22(23)25)16-7-5-8-17(29-2)21(16)26/h5,7-8,18,22H,4,6,9-15H2,1-3H3/t18-,22-,23-,24-/m0/s1 |
| InChIKey | YUMPPRJUVFVXJC-IMNFJDCFSA-N |
| XLogP | 3.27 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.53 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |