C20H20O6 — CID 162922972
2',3',5,7-tetramethoxyspiro[2H-chromene-3,8'-bicyclo[4.2.0]octa-1(6),2,4-triene]-4-one (PubChem CID 162922972) has the molecular formula C20H20O6 and a molecular weight of 356.37 g/mol. Its IUPAC name is 2',3',5,7-tetramethoxyspiro[2H-chromene-3,8'-bicyclo[4.2.0]octa-1(6),2,4-triene]-4-one.
| Compound Name | 2',3',5,7-tetramethoxyspiro[2H-chromene-3,8'-bicyclo[4.2.0]octa-1(6),2,4-triene]-4-one |
|---|---|
| PubChem CID | 162922972 |
| Molecular Formula | C20H20O6 |
| Molecular Weight | 356.37 g/mol |
| Exact Mass | 356.13 |
| IUPAC Name | 2',3',5,7-tetramethoxyspiro[2H-chromene-3,8'-bicyclo[4.2.0]octa-1(6),2,4-triene]-4-one |
| SMILES | COc1cc(OC)c2c(c1)OCC1(Cc3ccc(OC)c(OC)c31)C2=O |
| InChI | InChI=1S/C20H20O6/c1-22-12-7-14(24-3)16-15(8-12)26-10-20(19(16)21)9-11-5-6-13(23-2)18(25-4)17(11)20/h5-8H,9-10H2,1-4H3 |
| InChIKey | JGJJZNQODHHEPB-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.37 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |