C32H52O6 — CID 162923021
(1,2,11,14-tetrahydroxy-4,4,6a,6b,8a,11,12,14b-octamethyl-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicen-3-yl) acetate (PubChem CID 162923021) has the molecular formula C32H52O6 and a molecular weight of 532.76 g/mol. Its IUPAC name is (1,2,11,14-tetrahydroxy-4,4,6a,6b,8a,11,12,14b-octamethyl-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicen-3-yl) acetate.
| Compound Name | (1,2,11,14-tetrahydroxy-4,4,6a,6b,8a,11,12,14b-octamethyl-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicen-3-yl) acetate |
|---|---|
| PubChem CID | 162923021 |
| Molecular Formula | C32H52O6 |
| Molecular Weight | 532.76 g/mol |
| Exact Mass | 532.38 |
| IUPAC Name | (1,2,11,14-tetrahydroxy-4,4,6a,6b,8a,11,12,14b-octamethyl-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicen-3-yl) acetate |
| SMILES | CC(=O)OC1C(O)C(O)C2(C)C(CCC3(C)C2C(O)C=C2C4C(C)C(C)(O)CCC4(C)CCC23C)C1(C)C |
| InChI | InChI=1S/C32H52O6/c1-17-22-19-16-20(34)24-30(7,29(19,6)14-12-28(22,5)13-15-31(17,8)37)11-10-21-27(3,4)26(38-18(2)33)23(35)25(36)32(21,24)9/h16-17,20-26,34-37H,10-15H2,1-9H3 |
| InChIKey | WIPNLUPGNPNSLD-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.76 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|