C21H36O8 — CID 162923113
(2R,3S,4S,5R,6S)-2-(hydroxymethyl)-6-[2-[(2S,5R)-5-[(1E,4S)-4-hydroxy-4-methylhexa-1,5-dienyl]-5-methyloxolan-2-yl]propan-2-yloxy]oxane-3,4,5-triol (PubChem CID 162923113) has the molecular formula C21H36O8 and a molecular weight of 416.51 g/mol. Its IUPAC name is (2R,3S,4S,5R,6S)-2-(hydroxymethyl)-6-[2-[(2S,5R)-5-[(1E,4S)-4-hydroxy-4-methylhexa-1,5-dienyl]-5-methyloxolan-2-yl]propan-2-yloxy]oxane-3,4,5-triol.
| Compound Name | (2R,3S,4S,5R,6S)-2-(hydroxymethyl)-6-[2-[(2S,5R)-5-[(1E,4S)-4-hydroxy-4-methylhexa-1,5-dienyl]-5-methyloxolan-2-yl]propan-2-yloxy]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 162923113 |
| Molecular Formula | C21H36O8 |
| Molecular Weight | 416.51 g/mol |
| Exact Mass | 416.24 |
| IUPAC Name | (2R,3S,4S,5R,6S)-2-(hydroxymethyl)-6-[2-[(2S,5R)-5-[(1E,4S)-4-hydroxy-4-methylhexa-1,5-dienyl]-5-methyloxolan-2-yl]propan-2-yloxy]oxane-3,4,5-triol |
| SMILES | C=C[C@@](C)(O)C/C=C/[C@@]1(C)CC[C@@H](C(C)(C)O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)O1 |
| InChI | InChI=1S/C21H36O8/c1-6-20(4,26)9-7-10-21(5)11-8-14(28-21)19(2,3)29-18-17(25)16(24)15(23)13(12-22)27-18/h6-7,10,13-18,22-26H,1,8-9,11-12H2,2-5H3/b10-7+/t13-,14+,15-,16+,17-,18+,20-,21+/m1/s1 |
| InChIKey | UBWUZHMCADSLDT-KXSSXWBHSA-N |
| XLogP | 0.40 |
| TPSA | 128.84 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.51 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|