C23H37NO — CID 162923191
3-[1-(dimethylamino)ethyl]-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-one (PubChem CID 162923191) has the molecular formula C23H37NO and a molecular weight of 343.56 g/mol. Its IUPAC name is 3-[1-(dimethylamino)ethyl]-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-one.
| Compound Name | 3-[1-(dimethylamino)ethyl]-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-one |
|---|---|
| PubChem CID | 162923191 |
| Molecular Formula | C23H37NO |
| Molecular Weight | 343.56 g/mol |
| Exact Mass | 343.29 |
| IUPAC Name | 3-[1-(dimethylamino)ethyl]-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-one |
| SMILES | CC(C1CCC2(C)C(=CCC3C4CCC(=O)C4(C)CCC32)C1)N(C)C |
| InChI | InChI=1S/C23H37NO/c1-15(24(4)5)16-10-12-22(2)17(14-16)6-7-18-19-8-9-21(25)23(19,3)13-11-20(18)22/h6,15-16,18-20H,7-14H2,1-5H3 |
| InChIKey | PYDXFAVAROXWAK-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.56 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|