C22H32O13 — CID 162923233
(2R,3R,4S,5S,6S)-2-[[(2R,3R,4R)-3,4-dihydroxy-4-(hydroxymethyl)oxolan-2-yl]oxymethyl]-6-[3-(4-hydroxy-3,5-dimethoxyphenyl)prop-2-enoxy]oxane-3,4,5-triol (PubChem CID 162923233) has the molecular formula C22H32O13 and a molecular weight of 504.49 g/mol. Its IUPAC name is (2R,3R,4S,5S,6S)-2-[[(2R,3R,4R)-3,4-dihydroxy-4-(hydroxymethyl)oxolan-2-yl]oxymethyl]-6-[3-(4-hydroxy-3,5-dimethoxyphenyl)prop-2-enoxy]oxane-3,4,5-triol.
| Compound Name | (2R,3R,4S,5S,6S)-2-[[(2R,3R,4R)-3,4-dihydroxy-4-(hydroxymethyl)oxolan-2-yl]oxymethyl]-6-[3-(4-hydroxy-3,5-dimethoxyphenyl)prop-2-enoxy]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 162923233 |
| Molecular Formula | C22H32O13 |
| Molecular Weight | 504.49 g/mol |
| Exact Mass | 504.18 |
| IUPAC Name | (2R,3R,4S,5S,6S)-2-[[(2R,3R,4R)-3,4-dihydroxy-4-(hydroxymethyl)oxolan-2-yl]oxymethyl]-6-[3-(4-hydroxy-3,5-dimethoxyphenyl)prop-2-enoxy]oxane-3,4,5-triol |
| SMILES | COc1cc(C=CCO[C@H]2O[C@H](CO[C@@H]3OC[C@](O)(CO)[C@H]3O)[C@H](O)[C@H](O)[C@@H]2O)cc(OC)c1O |
| InChI | InChI=1S/C22H32O13/c1-30-12-6-11(7-13(31-2)15(12)24)4-3-5-32-20-18(27)17(26)16(25)14(35-20)8-33-21-19(28)22(29,9-23)10-34-21/h3-4,6-7,14,16-21,23-29H,5,8-10H2,1-2H3/t14-,16+,17+,18+,19+,20+,21-,22-/m1/s1 |
| InChIKey | AZWYALFKHJLDEH-YXNKXFRKSA-N |
| XLogP | -2.30 |
| TPSA | 196.99 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.49 |
| LogP ≤ 5 | -2.30 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 13 |