C15H24O2 — CID 162923462
(2E,4E,6S)-2-(2-hydroxyethyl)-6,10-dimethylundeca-2,4,9-trienal (PubChem CID 162923462) has the molecular formula C15H24O2 and a molecular weight of 236.35 g/mol. Its IUPAC name is (2E,4E,6S)-2-(2-hydroxyethyl)-6,10-dimethylundeca-2,4,9-trienal.
| Compound Name | (2E,4E,6S)-2-(2-hydroxyethyl)-6,10-dimethylundeca-2,4,9-trienal |
|---|---|
| PubChem CID | 162923462 |
| Molecular Formula | C15H24O2 |
| Molecular Weight | 236.35 g/mol |
| Exact Mass | 236.18 |
| IUPAC Name | (2E,4E,6S)-2-(2-hydroxyethyl)-6,10-dimethylundeca-2,4,9-trienal |
| SMILES | CC(C)=CCC[C@H](C)/C=C/C=C(/C=O)CCO |
| InChI | InChI=1S/C15H24O2/c1-13(2)6-4-7-14(3)8-5-9-15(12-17)10-11-16/h5-6,8-9,12,14,16H,4,7,10-11H2,1-3H3/b8-5+,15-9+/t14-/m0/s1 |
| InChIKey | GIRIYNJFIVVHNM-VOJQLNGMSA-N |
| XLogP | 3.43 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.35 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|