About CID 162923731
CID 162923731 (PubChem CID 162923731) has the molecular formula C23H38O4
and a molecular weight of 378.55 g/mol.
Molecular Properties
| Compound Name | CID 162923731 |
|---|
| PubChem CID | 162923731 |
|---|
| Molecular Formula | C23H38O4 |
|---|
| Molecular Weight | 378.55 g/mol |
|---|
| Exact Mass | 378.28 |
|---|
| IUPAC Name | — |
|---|
| SMILES | CCO[C@@H]1C[C@@]2(CC[C@@]3(O2)[C@H](C)C(=O)[C@@H](C)[C@H]2C(C)(C)CCC[C@@]23C)CO1 |
|---|
| InChI | InChI=1S/C23H38O4/c1-7-25-17-13-22(14-26-17)11-12-23(27-22)16(3)18(24)15(2)19-20(4,5)9-8-10-21(19,23)6/h15-17,19H,7-14H2,1-6H3/t15-,16-,17+,19+,21+,22+,23-/m1/s1 |
|---|
| InChIKey | PIERVVMAODGPOO-TZONGRIWSA-N |
|---|
| XLogP | 4.74 |
|---|
| TPSA | 44.76 Ų |
|---|
| H-Bond Donors | |
|---|
| H-Bond Acceptors | 4 |
|---|
| Rotatable Bonds | 2 |
|---|
| Heavy Atoms | 27 |
|---|
| Complexity | — |
|---|
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
|---|
| MW ≤ 500 | 378.55 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze CID 162923731 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 162923731?
The IUPAC name of CID 162923731 (CID 162923731) is not available.
What is the SMILES notation for CID 162923731?
The canonical SMILES for CID 162923731 is CCO[C@@H]1C[C@@]2(CC[C@@]3(O2)[C@H](C)C(=O)[C@@H](C)[C@H]2C(C)(C)CCC[C@@]23C)CO1.
What is the InChIKey of CID 162923731?
The InChIKey is PIERVVMAODGPOO-TZONGRIWSA-N. The full InChI is InChI=1S/C23H38O4/c1-7-25-17-13-22(14-26-17)11-12-23(27-22)16(3)18(24)15(2)19-20(4,5)9-8-10-21(19,23)6/h15-17,19H,7-14H2,1-6H3/t15-,16-,17+,19+,21+,22+,23-/m1/s1.
What are the key properties of CID 162923731?
CID 162923731 has a molecular weight of 378.55 g/mol, XLogP of 4.74, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 162923731 is sourced from PubChem (CID 162923731), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).