C15H22O4 — CID 162923937
(1R,2R,5R,6S,9S,10S)-1,5,9-trimethyl-3,14-dioxatricyclo[8.4.0.02,6]tetradecane-4,13-dione (PubChem CID 162923937) has the molecular formula C15H22O4 and a molecular weight of 266.34 g/mol. Its IUPAC name is (1R,2R,5R,6S,9S,10S)-1,5,9-trimethyl-3,14-dioxatricyclo[8.4.0.02,6]tetradecane-4,13-dione.
| Compound Name | (1R,2R,5R,6S,9S,10S)-1,5,9-trimethyl-3,14-dioxatricyclo[8.4.0.02,6]tetradecane-4,13-dione |
|---|---|
| PubChem CID | 162923937 |
| Molecular Formula | C15H22O4 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | (1R,2R,5R,6S,9S,10S)-1,5,9-trimethyl-3,14-dioxatricyclo[8.4.0.02,6]tetradecane-4,13-dione |
| SMILES | C[C@H]1CC[C@@H]2[C@@H](OC(=O)[C@@H]2C)[C@]2(C)OC(=O)CC[C@@H]12 |
| InChI | InChI=1S/C15H22O4/c1-8-4-5-10-9(2)14(17)18-13(10)15(3)11(8)6-7-12(16)19-15/h8-11,13H,4-7H2,1-3H3/t8-,9+,10-,11-,13+,15+/m0/s1 |
| InChIKey | ZUHAFCDVANLIDK-MYBATQTQSA-N |
| XLogP | 2.31 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |