C42H32O9 — CID 162924102
(2R,3R,10S,11R,19S)-3,11,19-tris(4-hydroxyphenyl)-20-oxahexacyclo[16.6.1.02,10.04,9.012,17.021,25]pentacosa-1(25),4(9),5,7,12(17),13,15,21,23-nonaene-5,7,13,15,23-pentol (PubChem CID 162924102) has the molecular formula C42H32O9 and a molecular weight of 680.71 g/mol. Its IUPAC name is (2R,3R,10S,11R,19S)-3,11,19-tris(4-hydroxyphenyl)-20-oxahexacyclo[16.6.1.02,10.04,9.012,17.021,25]pentacosa-1(25),4(9),5,7,12(17),13,15,21,23-nonaene-5,7,13,15,23-pentol.
| Compound Name | (2R,3R,10S,11R,19S)-3,11,19-tris(4-hydroxyphenyl)-20-oxahexacyclo[16.6.1.02,10.04,9.012,17.021,25]pentacosa-1(25),4(9),5,7,12(17),13,15,21,23-nonaene-5,7,13,15,23-pentol |
|---|---|
| PubChem CID | 162924102 |
| Molecular Formula | C42H32O9 |
| Molecular Weight | 680.71 g/mol |
| Exact Mass | 680.20 |
| IUPAC Name | (2R,3R,10S,11R,19S)-3,11,19-tris(4-hydroxyphenyl)-20-oxahexacyclo[16.6.1.02,10.04,9.012,17.021,25]pentacosa-1(25),4(9),5,7,12(17),13,15,21,23-nonaene-5,7,13,15,23-pentol |
| SMILES | Oc1ccc([C@@H]2c3c(O)cc(O)cc3C3c4c(cc(O)cc4[C@H]4[C@H](c5ccc(O)cc5)c5c(O)cc(O)cc5[C@H]24)O[C@@H]3c2ccc(O)cc2)cc1 |
| InChI | InChI=1S/C42H32O9/c43-22-7-1-19(2-8-22)34-36-28(13-25(46)16-31(36)49)39-35(20-3-9-23(44)10-4-20)37-29(14-26(47)17-32(37)50)41-38-30(40(34)39)15-27(48)18-33(38)51-42(41)21-5-11-24(45)12-6-21/h1-18,34-35,39-50H/t34-,35-,39-,40+,41?,42-/m1/s1 |
| InChIKey | UXHSAOFTHSNXMK-RHNOVOHCSA-N |
| XLogP | 7.76 |
| TPSA | 171.07 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.71 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 9 |