C31H50O6 — CID 162924497
methyl (1S,4aR,6aS,6bR,10S,12aR)-1,10-dihydroxy-9,9-bis(hydroxymethyl)-2,2,6a,6b,12a-pentamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4a-carboxylate (PubChem CID 162924497) has the molecular formula C31H50O6 and a molecular weight of 518.74 g/mol. Its IUPAC name is methyl (1S,4aR,6aS,6bR,10S,12aR)-1,10-dihydroxy-9,9-bis(hydroxymethyl)-2,2,6a,6b,12a-pentamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4a-carboxylate.
| Compound Name | methyl (1S,4aR,6aS,6bR,10S,12aR)-1,10-dihydroxy-9,9-bis(hydroxymethyl)-2,2,6a,6b,12a-pentamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4a-carboxylate |
|---|---|
| PubChem CID | 162924497 |
| Molecular Formula | C31H50O6 |
| Molecular Weight | 518.74 g/mol |
| Exact Mass | 518.36 |
| IUPAC Name | methyl (1S,4aR,6aS,6bR,10S,12aR)-1,10-dihydroxy-9,9-bis(hydroxymethyl)-2,2,6a,6b,12a-pentamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4a-carboxylate |
| SMILES | COC(=O)[C@]12CCC(C)(C)[C@@H](O)C1C1=CCC3[C@@]4(C)CC[C@H](O)C(CO)(CO)C4CC[C@@]3(C)[C@]1(C)CC2 |
| InChI | InChI=1S/C31H50O6/c1-26(2)13-15-30(25(36)37-6)16-14-28(4)19(23(30)24(26)35)7-8-20-27(3)11-10-22(34)31(17-32,18-33)21(27)9-12-29(20,28)5/h7,20-24,32-35H,8-18H2,1-6H3/t20?,21?,22-,23?,24-,27+,28+,29+,30-/m0/s1 |
| InChIKey | ILNUAJNZFQMDHR-WAGUVUIQSA-N |
| XLogP | 4.24 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.74 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|